C10H12F3N7S — CID 106434069
4-N-methyl-6-pyrazol-1-yl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 106434069) has the molecular formula C10H12F3N7S and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-N-methyl-6-pyrazol-1-yl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-methyl-6-pyrazol-1-yl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106434069 |
| Molecular Formula | C10H12F3N7S |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-N-methyl-6-pyrazol-1-yl-2-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(NCCSC(F)(F)F)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H12F3N7S/c1-14-7-17-8(15-4-6-21-10(11,12)13)19-9(18-7)20-5-2-3-16-20/h2-3,5H,4,6H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | NJZQEIMOTPASMH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|