C10H12F3N7 — CID 115523062
6-pyrazol-1-yl-2-N-(4,4,4-trifluorobutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 115523062) has the molecular formula C10H12F3N7 and a molecular weight of 287.25 g/mol. Its IUPAC name is 6-pyrazol-1-yl-2-N-(4,4,4-trifluorobutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-pyrazol-1-yl-2-N-(4,4,4-trifluorobutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 115523062 |
| Molecular Formula | C10H12F3N7 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 6-pyrazol-1-yl-2-N-(4,4,4-trifluorobutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCCCC(F)(F)F)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H12F3N7/c11-10(12,13)3-1-4-15-8-17-7(14)18-9(19-8)20-6-2-5-16-20/h2,5-6H,1,3-4H2,(H3,14,15,17,18,19) |
| InChIKey | VLRJNWCUWKACDV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|