C12H17N7O — CID 80846232
2-N-(oxan-4-ylmethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80846232) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-N-(oxan-4-ylmethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(oxan-4-ylmethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80846232 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-N-(oxan-4-ylmethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCC2CCOCC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H17N7O/c13-10-16-11(14-8-9-2-6-20-7-3-9)18-12(17-10)19-5-1-4-15-19/h1,4-5,9H,2-3,6-8H2,(H3,13,14,16,17,18) |
| InChIKey | WVIUTWNHGONXHA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |