C10H13N7O — CID 80853473
2-N-(oxolan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80853473) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-N-(oxolan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(oxolan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80853473 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-N-(oxolan-3-yl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NC2CCOC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H13N7O/c11-8-14-9(13-7-2-5-18-6-7)16-10(15-8)17-4-1-3-12-17/h1,3-4,7H,2,5-6H2,(H3,11,13,14,15,16) |
| InChIKey | ZNBILUCWROJMND-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |