C11H15N7O — CID 80764921
1-(4-amino-6-pyrazol-1-yl-1,3,5-triazin-2-yl)piperidin-4-ol (PubChem CID 80764921) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-(4-amino-6-pyrazol-1-yl-1,3,5-triazin-2-yl)piperidin-4-ol.
| Compound Name | 1-(4-amino-6-pyrazol-1-yl-1,3,5-triazin-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 80764921 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-(4-amino-6-pyrazol-1-yl-1,3,5-triazin-2-yl)piperidin-4-ol |
| SMILES | Nc1nc(N2CCC(O)CC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H15N7O/c12-9-14-10(17-6-2-8(19)3-7-17)16-11(15-9)18-5-1-4-13-18/h1,4-5,8,19H,2-3,6-7H2,(H2,12,14,15,16) |
| InChIKey | KBYSEIOGAJJAGW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |