C11H15N7 — CID 80765065
4-piperidin-1-yl-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80765065) has the molecular formula C11H15N7 and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-piperidin-1-yl-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-piperidin-1-yl-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80765065 |
| Molecular Formula | C11H15N7 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-piperidin-1-yl-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCCCC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H15N7/c12-9-14-10(17-6-2-1-3-7-17)16-11(15-9)18-8-4-5-13-18/h4-5,8H,1-3,6-7H2,(H2,12,14,15,16) |
| InChIKey | DYKJIMWEPBDOLH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |