C12H15ClN6 — CID 62869697
1-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)azepane (PubChem CID 62869697) has the molecular formula C12H15ClN6 and a molecular weight of 278.75 g/mol. Its IUPAC name is 1-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)azepane.
| Compound Name | 1-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)azepane |
|---|---|
| PubChem CID | 62869697 |
| Molecular Formula | C12H15ClN6 |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)azepane |
| SMILES | Clc1nc(N2CCCCCC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H15ClN6/c13-10-15-11(18-7-3-1-2-4-8-18)17-12(16-10)19-9-5-6-14-19/h5-6,9H,1-4,7-8H2 |
| InChIKey | UZNKTEAHAGXVBD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |