C13H16ClN7 — CID 79931341
2-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 79931341) has the molecular formula C13H16ClN7 and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79931341 |
| Molecular Formula | C13H16ClN7 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Clc1nc(N2CCN3CCCC3C2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H16ClN7/c14-11-16-12(18-13(17-11)21-6-2-4-15-21)20-8-7-19-5-1-3-10(19)9-20/h2,4,6,10H,1,3,5,7-9H2 |
| InChIKey | ZXGNRGPXGSWURK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |