C12H19ClN6 — CID 79943695
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 79943695) has the molecular formula C12H19ClN6 and a molecular weight of 282.78 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79943695 |
| Molecular Formula | C12H19ClN6 |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-chloro-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(Cl)nc(N2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C12H19ClN6/c1-17(2)11-14-10(13)15-12(16-11)19-7-6-18-5-3-4-9(18)8-19/h9H,3-8H2,1-2H3 |
| InChIKey | AMYBKOOLRXXRSJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |