C11H17ClN6 — CID 80854716
4-chloro-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80854716) has the molecular formula C11H17ClN6 and a molecular weight of 268.75 g/mol. Its IUPAC name is 4-chloro-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80854716 |
| Molecular Formula | C11H17ClN6 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 4-chloro-6-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1CN2CCCC2CN1c1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C11H17ClN6/c1-7-5-17-4-2-3-8(17)6-18(7)11-15-9(12)14-10(13)16-11/h7-8H,2-6H2,1H3,(H2,13,14,15,16) |
| InChIKey | QBUMWSNAJKGLEA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |