C11H16ClN5 — CID 82752450
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-1,3,5-triazin-2-amine (PubChem CID 82752450) has the molecular formula C11H16ClN5 and a molecular weight of 253.74 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82752450 |
| Molecular Formula | C11H16ClN5 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C11H16ClN5/c12-9-14-10(13)16-11(15-9)17-6-5-7-3-1-2-4-8(7)17/h7-8H,1-6H2,(H2,13,14,15,16) |
| InChIKey | AAFMNAJDOUEBLD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |