C13H20ClN5 — CID 82752307
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 82752307) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82752307 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chloro-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Cl)nc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C13H20ClN5/c1-2-15-12-16-11(14)17-13(18-12)19-8-7-9-5-3-4-6-10(9)19/h9-10H,2-8H2,1H3,(H,15,16,17,18) |
| InChIKey | HSUCEPZWRHJQQL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |