C10H16N4S — CID 82751546
5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazol-3-amine (PubChem CID 82751546) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 82751546 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,4-thiadiazol-3-amine |
| SMILES | Nc1nsc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C10H16N4S/c11-9-12-10(15-13-9)14-6-5-7-3-1-2-4-8(7)14/h7-8H,1-6H2,(H2,11,13) |
| InChIKey | PUMDGRIBDQIDHQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |