C14H17ClF3N3 — CID 102716047
2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 102716047) has the molecular formula C14H17ClF3N3 and a molecular weight of 319.76 g/mol. Its IUPAC name is 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 102716047 |
| Molecular Formula | C14H17ClF3N3 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1CN2CCCC2CN1c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C14H17ClF3N3/c1-9-7-20-4-2-3-11(20)8-21(9)13-6-10(14(16,17)18)5-12(15)19-13/h5-6,9,11H,2-4,7-8H2,1H3 |
| InChIKey | GTNKXVMFLVROFP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|