C12H14ClF3N2O — CID 102715513
4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylmorpholine (PubChem CID 102715513) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylmorpholine.
| Compound Name | 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylmorpholine |
|---|---|
| PubChem CID | 102715513 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2,5-dimethylmorpholine |
| SMILES | CC1CN(c2cc(C(F)(F)F)cc(Cl)n2)C(C)CO1 |
| InChI | InChI=1S/C12H14ClF3N2O/c1-7-6-19-8(2)5-18(7)11-4-9(12(14,15)16)3-10(13)17-11/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | CLSGBAMUMMQKMT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|