C14H17ClF2N2 — CID 83082551
2-(2-chloro-4,6-difluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 83082551) has the molecular formula C14H17ClF2N2 and a molecular weight of 286.75 g/mol. Its IUPAC name is 2-(2-chloro-4,6-difluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(2-chloro-4,6-difluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 83082551 |
| Molecular Formula | C14H17ClF2N2 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(2-chloro-4,6-difluorophenyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1CN2CCCC2CN1c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C14H17ClF2N2/c1-9-7-18-4-2-3-11(18)8-19(9)14-12(15)5-10(16)6-13(14)17/h5-6,9,11H,2-4,7-8H2,1H3 |
| InChIKey | GJGUVWDHVGCJPN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |