C15H22ClN3 — CID 79941249
[3-chloro-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]methanamine (PubChem CID 79941249) has the molecular formula C15H22ClN3 and a molecular weight of 279.82 g/mol. Its IUPAC name is [3-chloro-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]methanamine.
| Compound Name | [3-chloro-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 79941249 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.82 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [3-chloro-4-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]methanamine |
| SMILES | CC1CN2CCCC2CN1c1ccc(CN)cc1Cl |
| InChI | InChI=1S/C15H22ClN3/c1-11-9-18-6-2-3-13(18)10-19(11)15-5-4-12(8-17)7-14(15)16/h4-5,7,11,13H,2-3,6,8-10,17H2,1H3 |
| InChIKey | MRHVNAGYSRHAQX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |