C15H23ClN4 — CID 79924881
[5-chloro-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanamine (PubChem CID 79924881) has the molecular formula C15H23ClN4 and a molecular weight of 294.83 g/mol. Its IUPAC name is [5-chloro-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanamine.
| Compound Name | [5-chloro-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 79924881 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [5-chloro-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanamine |
| SMILES | CC1CN2CCCCC2CN1c1ncc(CN)cc1Cl |
| InChI | InChI=1S/C15H23ClN4/c1-11-9-19-5-3-2-4-13(19)10-20(11)15-14(16)6-12(7-17)8-18-15/h6,8,11,13H,2-5,7,9-10,17H2,1H3 |
| InChIKey | YFVBMYYIUJSWDM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |