C15H22BrN3O — CID 79935278
[5-bromo-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanol (PubChem CID 79935278) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is [5-bromo-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanol.
| Compound Name | [5-bromo-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 79935278 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [5-bromo-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-pyridinyl]methanol |
| SMILES | CC1CN2CCCCC2CN1c1ncc(Br)cc1CO |
| InChI | InChI=1S/C15H22BrN3O/c1-11-8-18-5-3-2-4-14(18)9-19(11)15-12(10-20)6-13(16)7-17-15/h6-7,11,14,20H,2-5,8-10H2,1H3 |
| InChIKey | DVOOZBZECODDTI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |