C13H17ClN2 — CID 63087172
[4-(2-azabicyclo[2.2.1]heptan-2-yl)-3-chlorophenyl]methanamine (PubChem CID 63087172) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is [4-(2-azabicyclo[2.2.1]heptan-2-yl)-3-chlorophenyl]methanamine.
| Compound Name | [4-(2-azabicyclo[2.2.1]heptan-2-yl)-3-chlorophenyl]methanamine |
|---|---|
| PubChem CID | 63087172 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | [4-(2-azabicyclo[2.2.1]heptan-2-yl)-3-chlorophenyl]methanamine |
| SMILES | NCc1ccc(N2CC3CCC2C3)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2/c14-12-6-9(7-15)2-4-13(12)16-8-10-1-3-11(16)5-10/h2,4,6,10-11H,1,3,5,7-8,15H2 |
| InChIKey | VQECOMSLXNFSIX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |