C14H23ClN6 — CID 81200217
4-chloro-N,N-dimethyl-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3,5-triazin-2-amine (PubChem CID 81200217) has the molecular formula C14H23ClN6 and a molecular weight of 310.83 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-dimethyl-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 81200217 |
| Molecular Formula | C14H23ClN6 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-chloro-N,N-dimethyl-6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(Cl)nc(N2CCC3C(CCCN3C)C2)n1 |
| InChI | InChI=1S/C14H23ClN6/c1-19(2)13-16-12(15)17-14(18-13)21-8-6-11-10(9-21)5-4-7-20(11)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | SUWAZKBXQRQQFK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |