C11H17ClN4S — CID 81198645
3-chloro-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,2,5-thiadiazole (PubChem CID 81198645) has the molecular formula C11H17ClN4S and a molecular weight of 272.81 g/mol. Its IUPAC name is 3-chloro-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 81198645 |
| Molecular Formula | C11H17ClN4S |
| Molecular Weight | 272.81 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-chloro-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,2,5-thiadiazole |
| SMILES | CN1CCCC2CN(c3nsnc3Cl)CCC21 |
| InChI | InChI=1S/C11H17ClN4S/c1-15-5-2-3-8-7-16(6-4-9(8)15)11-10(12)13-17-14-11/h8-9H,2-7H2,1H3 |
| InChIKey | RPROKFJJLBGOBS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |