C13H20ClN3OS — CID 81199670
[4-chloro-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 81199670) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is [4-chloro-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-chloro-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 81199670 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [4-chloro-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | CN1CCCC2CN(c3nc(Cl)c(CO)s3)CCC21 |
| InChI | InChI=1S/C13H20ClN3OS/c1-16-5-2-3-9-7-17(6-4-10(9)16)13-15-12(14)11(8-18)19-13/h9-10,18H,2-8H2,1H3 |
| InChIKey | GSUYLWILMCIYAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |