C14H23N3OS — CID 81206184
[4-methyl-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 81206184) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is [4-methyl-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-methyl-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 81206184 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [4-methyl-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1nc(N2CCC3C(CCCN3C)C2)sc1CO |
| InChI | InChI=1S/C14H23N3OS/c1-10-13(9-18)19-14(15-10)17-7-5-12-11(8-17)4-3-6-16(12)2/h11-12,18H,3-9H2,1-2H3 |
| InChIKey | UZIJBEKLNFKYAG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |