C12H17Cl2N5 — CID 81200530
6-(3,6-dichloro-1,2,4-triazin-5-yl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 81200530) has the molecular formula C12H17Cl2N5 and a molecular weight of 302.21 g/mol. Its IUPAC name is 6-(3,6-dichloro-1,2,4-triazin-5-yl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 6-(3,6-dichloro-1,2,4-triazin-5-yl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 81200530 |
| Molecular Formula | C12H17Cl2N5 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 6-(3,6-dichloro-1,2,4-triazin-5-yl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CN1CCCC2CN(c3nc(Cl)nnc3Cl)CCC21 |
| InChI | InChI=1S/C12H17Cl2N5/c1-18-5-2-3-8-7-19(6-4-9(8)18)11-10(13)16-17-12(14)15-11/h8-9H,2-7H2,1H3 |
| InChIKey | LBXUULRFAFXYCL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |