C9H12Cl2N4O — CID 102963145
1-(3,6-dichloro-1,2,4-triazin-5-yl)-4-methylpiperidin-3-ol (PubChem CID 102963145) has the molecular formula C9H12Cl2N4O and a molecular weight of 263.13 g/mol. Its IUPAC name is 1-(3,6-dichloro-1,2,4-triazin-5-yl)-4-methylpiperidin-3-ol.
| Compound Name | 1-(3,6-dichloro-1,2,4-triazin-5-yl)-4-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 102963145 |
| Molecular Formula | C9H12Cl2N4O |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(3,6-dichloro-1,2,4-triazin-5-yl)-4-methylpiperidin-3-ol |
| SMILES | CC1CCN(c2nc(Cl)nnc2Cl)CC1O |
| InChI | InChI=1S/C9H12Cl2N4O/c1-5-2-3-15(4-6(5)16)8-7(10)13-14-9(11)12-8/h5-6,16H,2-4H2,1H3 |
| InChIKey | HRSPOBFAKFOHHH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |