C11H16Cl2N4 — CID 103500970
3,6-dichloro-5-(4-propan-2-ylpiperidin-1-yl)-1,2,4-triazine (PubChem CID 103500970) has the molecular formula C11H16Cl2N4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 3,6-dichloro-5-(4-propan-2-ylpiperidin-1-yl)-1,2,4-triazine.
| Compound Name | 3,6-dichloro-5-(4-propan-2-ylpiperidin-1-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 103500970 |
| Molecular Formula | C11H16Cl2N4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3,6-dichloro-5-(4-propan-2-ylpiperidin-1-yl)-1,2,4-triazine |
| SMILES | CC(C)C1CCN(c2nc(Cl)nnc2Cl)CC1 |
| InChI | InChI=1S/C11H16Cl2N4/c1-7(2)8-3-5-17(6-4-8)10-9(12)15-16-11(13)14-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | IUMUMDDQHHGKBN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |