C14H23N5 — CID 81205894
5-methyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyrimidin-2-amine (PubChem CID 81205894) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 5-methyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyrimidin-2-amine.
| Compound Name | 5-methyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 81205894 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 5-methyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyrimidin-2-amine |
| SMILES | Cc1cnc(N)nc1N1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C14H23N5/c1-10-8-16-14(15)17-13(10)19-7-5-12-11(9-19)4-3-6-18(12)2/h8,11-12H,3-7,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | XMDKDZLCIHDFGZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |