C12H18N4 — CID 18596266
(5aS,9aS)-6-methyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine (PubChem CID 18596266) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is (5aS,9aS)-6-methyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine.
| Compound Name | (5aS,9aS)-6-methyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine |
|---|---|
| PubChem CID | 18596266 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (5aS,9aS)-6-methyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine |
| SMILES | CN1CCC[C@H]2Cc3nc(N)ncc3C[C@@H]21 |
| InChI | InChI=1S/C12H18N4/c1-16-4-2-3-8-5-10-9(6-11(8)16)7-14-12(13)15-10/h7-8,11H,2-6H2,1H3,(H2,13,14,15)/t8-,11-/m0/s1 |
| InChIKey | UEKDYDQPOFVKAZ-KWQFWETISA-N |
| XLogP | 0.87 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |