C14H20BrNO2 — CID 66588710
(4aR,10aR)-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-6,7-diol;hydrobromide (PubChem CID 66588710) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is (4aR,10aR)-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-6,7-diol;hydrobromide.
| Compound Name | (4aR,10aR)-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-6,7-diol;hydrobromide |
|---|---|
| PubChem CID | 66588710 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (4aR,10aR)-1-methyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-6,7-diol;hydrobromide |
| SMILES | Br.CN1CCC[C@@H]2Cc3c(ccc(O)c3O)C[C@H]21 |
| InChI | InChI=1S/C14H19NO2.BrH/c1-15-6-2-3-10-7-11-9(8-12(10)15)4-5-13(16)14(11)17;/h4-5,10,12,16-17H,2-3,6-8H2,1H3;1H/t10-,12-;/m1./s1 |
| InChIKey | IEEKYAGIAVWHLL-MHDYBILJSA-N |
| XLogP | 2.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|