C11H17N3 — CID 56635030
(4aS,8aS)-5-methyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline (PubChem CID 56635030) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (4aS,8aS)-5-methyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline.
| Compound Name | (4aS,8aS)-5-methyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline |
|---|---|
| PubChem CID | 56635030 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (4aS,8aS)-5-methyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinoline |
| SMILES | CN1CCC[C@H]2Cc3[nH]ncc3C[C@@H]21 |
| InChI | InChI=1S/C11H17N3/c1-14-4-2-3-8-5-10-9(6-11(8)14)7-12-13-10/h7-8,11H,2-6H2,1H3,(H,12,13)/t8-,11-/m0/s1 |
| InChIKey | ZWWUTJVKHKIVRC-KWQFWETISA-N |
| XLogP | 1.22 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |