C16H22NNa2O5P — CID 155724665
disodium;[(4aR,10aR)-7-hydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl] phosphate (PubChem CID 155724665) has the molecular formula C16H22NNa2O5P and a molecular weight of 385.31 g/mol. Its IUPAC name is disodium;[(4aR,10aR)-7-hydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl] phosphate.
| Compound Name | disodium;[(4aR,10aR)-7-hydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl] phosphate |
|---|---|
| PubChem CID | 155724665 |
| Molecular Formula | C16H22NNa2O5P |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | disodium;[(4aR,10aR)-7-hydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl] phosphate |
| SMILES | CCCN1CCC[C@@H]2Cc3c(ccc(O)c3OP(=O)([O-])[O-])C[C@H]21.[Na+].[Na+] |
| InChI | InChI=1S/C16H24NO5P.2Na/c1-2-7-17-8-3-4-12-9-13-11(10-14(12)17)5-6-15(18)16(13)22-23(19,20)21;;/h5-6,12,14,18H,2-4,7-10H2,1H3,(H2,19,20,21);;/q;2*+1/p-2/t12-,14-;;/m1../s1 |
| InChIKey | JFXXNBBXZWOROZ-OJNIYTAOSA-L |
| XLogP | -4.80 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|