C26H45NOSi — CID 158390149
[(4aR,10aR)-7-methyl-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]oxy-tri(propan-2-yl)silane (PubChem CID 158390149) has the molecular formula C26H45NOSi and a molecular weight of 415.74 g/mol. Its IUPAC name is [(4aR,10aR)-7-methyl-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(4aR,10aR)-7-methyl-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 158390149 |
| Molecular Formula | C26H45NOSi |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | [(4aR,10aR)-7-methyl-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-6-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCN1CCC[C@@H]2Cc3c(ccc(C)c3O[Si](C(C)C)(C(C)C)C(C)C)C[C@H]21 |
| InChI | InChI=1S/C26H45NOSi/c1-9-14-27-15-10-11-23-16-24-22(17-25(23)27)13-12-21(8)26(24)28-29(18(2)3,19(4)5)20(6)7/h12-13,18-20,23,25H,9-11,14-17H2,1-8H3/t23-,25-/m1/s1 |
| InChIKey | TWYWHPCHWBBIEX-ILBGXUMGSA-N |
| XLogP | 7.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|