C18H26O2 — CID 143768999
(11aR)-8-ethyl-5,5a,6,7,8,9,10,11,11a,12-decahydrocycloocta[g]naphthalene-1,2-diol (PubChem CID 143768999) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (11aR)-8-ethyl-5,5a,6,7,8,9,10,11,11a,12-decahydrocycloocta[g]naphthalene-1,2-diol.
| Compound Name | (11aR)-8-ethyl-5,5a,6,7,8,9,10,11,11a,12-decahydrocycloocta[g]naphthalene-1,2-diol |
|---|---|
| PubChem CID | 143768999 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (11aR)-8-ethyl-5,5a,6,7,8,9,10,11,11a,12-decahydrocycloocta[g]naphthalene-1,2-diol |
| SMILES | CCC1CCC[C@@H]2Cc3c(ccc(O)c3O)CC2CC1 |
| InChI | InChI=1S/C18H26O2/c1-2-12-4-3-5-13-11-16-15(10-14(13)7-6-12)8-9-17(19)18(16)20/h8-9,12-14,19-20H,2-7,10-11H2,1H3/t12?,13-,14?/m1/s1 |
| InChIKey | JXQZIUSSQKLHTH-ROKHWSDSSA-N |
| XLogP | 4.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|