C14H23NO2 — CID 143769051
N-methylethanamine;6-methyl-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 143769051) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-methylethanamine;6-methyl-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | N-methylethanamine;6-methyl-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 143769051 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-methylethanamine;6-methyl-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CC1CCc2c(ccc(O)c2O)C1.CCNC |
| InChI | InChI=1S/C11H14O2.C3H9N/c1-7-2-4-9-8(6-7)3-5-10(12)11(9)13;1-3-4-2/h3,5,7,12-13H,2,4,6H2,1H3;4H,3H2,1-2H3 |
| InChIKey | LOCQUSMENNWDKY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|