C18H31N — CID 177367040
N-methylethanamine;7-methyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulene (PubChem CID 177367040) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is N-methylethanamine;7-methyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulene.
| Compound Name | N-methylethanamine;7-methyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulene |
|---|---|
| PubChem CID | 177367040 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N-methylethanamine;7-methyl-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulene |
| SMILES | CC1CCCCCc2ccccc2CC1.CCNC |
| InChI | InChI=1S/C15H22.C3H9N/c1-13-7-3-2-4-8-14-9-5-6-10-15(14)12-11-13;1-3-4-2/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3;4H,3H2,1-2H3 |
| InChIKey | FWHUCARBRRIXRJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |