C14H20O — CID 135280990
5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-7-ol (PubChem CID 135280990) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-7-ol.
| Compound Name | 5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-7-ol |
|---|---|
| PubChem CID | 135280990 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-7-ol |
| SMILES | OC1CCCCCc2ccccc2CC1 |
| InChI | InChI=1S/C14H20O/c15-14-9-3-1-2-6-12-7-4-5-8-13(12)10-11-14/h4-5,7-8,14-15H,1-3,6,9-11H2 |
| InChIKey | QYRCUMHXRYRPCR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |