C12H16O — CID 130614926
(5R)-5,6,7,8,9,10-hexahydrobenzo[8]annulen-5-ol (PubChem CID 130614926) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (5R)-5,6,7,8,9,10-hexahydrobenzo[8]annulen-5-ol.
| Compound Name | (5R)-5,6,7,8,9,10-hexahydrobenzo[8]annulen-5-ol |
|---|---|
| PubChem CID | 130614926 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (5R)-5,6,7,8,9,10-hexahydrobenzo[8]annulen-5-ol |
| SMILES | O[C@@H]1CCCCCc2ccccc21 |
| InChI | InChI=1S/C12H16O/c13-12-9-3-1-2-6-10-7-4-5-8-11(10)12/h4-5,7-8,12-13H,1-3,6,9H2/t12-/m1/s1 |
| InChIKey | QXCINMTYMAIYDC-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |