C12H16O2 — CID 121014206
5,6,7,8,9,10-hexahydrobenzo[8]annulene-5,6-diol (PubChem CID 121014206) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5,6,7,8,9,10-hexahydrobenzo[8]annulene-5,6-diol.
| Compound Name | 5,6,7,8,9,10-hexahydrobenzo[8]annulene-5,6-diol |
|---|---|
| PubChem CID | 121014206 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5,6,7,8,9,10-hexahydrobenzo[8]annulene-5,6-diol |
| SMILES | OC1CCCCc2ccccc2C1O |
| InChI | InChI=1S/C12H16O2/c13-11-8-4-2-6-9-5-1-3-7-10(9)12(11)14/h1,3,5,7,11-14H,2,4,6,8H2 |
| InChIKey | PDYIEXRXYPOECR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |