C11H14O2 — CID 12522311
2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 12522311) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 12522311 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-(hydroxymethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OCC1CCc2ccccc2C1O |
| InChI | InChI=1S/C11H14O2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-4,9,11-13H,5-7H2 |
| InChIKey | UQMWWSHYEBAVIE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |