C19H18O — CID 62339034
2-(3-phenylprop-2-ynyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 62339034) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(3-phenylprop-2-ynyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 2-(3-phenylprop-2-ynyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 62339034 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(3-phenylprop-2-ynyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1c2ccccc2CCC1CC#Cc1ccccc1 |
| InChI | InChI=1S/C19H18O/c20-19-17(11-6-9-15-7-2-1-3-8-15)14-13-16-10-4-5-12-18(16)19/h1-5,7-8,10,12,17,19-20H,11,13-14H2 |
| InChIKey | IRGUQLFQZYFBPH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|