C11H15NO — CID 13125681
5-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-ol (PubChem CID 13125681) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-ol.
| Compound Name | 5-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-ol |
|---|---|
| PubChem CID | 13125681 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-ol |
| SMILES | NC1c2ccccc2CCCC1O |
| InChI | InChI=1S/C11H15NO/c12-11-9-6-2-1-4-8(9)5-3-7-10(11)13/h1-2,4,6,10-11,13H,3,5,7,12H2 |
| InChIKey | BTRCHTMVMNPPSF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |