About 1,1'-biphenyl;cyclohexanol
1,1'-biphenyl;cyclohexanol (PubChem CID 142137438) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 1,1'-biphenyl;cyclohexanol.
Molecular Properties
| Compound Name | 1,1'-biphenyl;cyclohexanol |
| PubChem CID | 142137438 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1,1'-biphenyl;cyclohexanol |
| SMILES | OC1CCCCC1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H12O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-10H;6-7H,1-5H2 |
| InChIKey | FLHSJKWHIRUXDC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1'-biphenyl;cyclohexanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;cyclohexanol?
The IUPAC name of 1,1'-biphenyl;cyclohexanol (CID 142137438) is 1,1'-biphenyl;cyclohexanol.
What is the SMILES notation for 1,1'-biphenyl;cyclohexanol?
The canonical SMILES for 1,1'-biphenyl;cyclohexanol is OC1CCCCC1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;cyclohexanol?
The InChIKey is FLHSJKWHIRUXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C6H12O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-10H;6-7H,1-5H2.
What are the key properties of 1,1'-biphenyl;cyclohexanol?
1,1'-biphenyl;cyclohexanol has a molecular weight of 254.37 g/mol, XLogP of 4.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;cyclohexanol is sourced from PubChem (CID 142137438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).