About cyclohexanol;1-phenylethanone
cyclohexanol;1-phenylethanone (PubChem CID 22467660) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is cyclohexanol;1-phenylethanone.
Molecular Properties
| Compound Name | cyclohexanol;1-phenylethanone |
| PubChem CID | 22467660 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | cyclohexanol;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.OC1CCCCC1 |
| InChI | InChI=1S/C8H8O.C6H12O/c1-7(9)8-5-3-2-4-6-8;7-6-4-2-1-3-5-6/h2-6H,1H3;6-7H,1-5H2 |
| InChIKey | YCDXNPAEENQLOW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanol;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;1-phenylethanone?
The IUPAC name of cyclohexanol;1-phenylethanone (CID 22467660) is cyclohexanol;1-phenylethanone.
What is the SMILES notation for cyclohexanol;1-phenylethanone?
The canonical SMILES for cyclohexanol;1-phenylethanone is CC(=O)c1ccccc1.OC1CCCCC1.
What is the InChIKey of cyclohexanol;1-phenylethanone?
The InChIKey is YCDXNPAEENQLOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H12O/c1-7(9)8-5-3-2-4-6-8;7-6-4-2-1-3-5-6/h2-6H,1H3;6-7H,1-5H2.
What are the key properties of cyclohexanol;1-phenylethanone?
cyclohexanol;1-phenylethanone has a molecular weight of 220.31 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;1-phenylethanone is sourced from PubChem (CID 22467660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).