About cyclohexanol;prop-1-en-2-ylbenzene
cyclohexanol;prop-1-en-2-ylbenzene (PubChem CID 69052526) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is cyclohexanol;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | cyclohexanol;prop-1-en-2-ylbenzene |
| PubChem CID | 69052526 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | cyclohexanol;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.OC1CCCCC1 |
| InChI | InChI=1S/C9H10.C6H12O/c1-8(2)9-6-4-3-5-7-9;7-6-4-2-1-3-5-6/h3-7H,1H2,2H3;6-7H,1-5H2 |
| InChIKey | XPFRBKFWDQBIFF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexanol;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;prop-1-en-2-ylbenzene?
The IUPAC name of cyclohexanol;prop-1-en-2-ylbenzene (CID 69052526) is cyclohexanol;prop-1-en-2-ylbenzene.
What is the SMILES notation for cyclohexanol;prop-1-en-2-ylbenzene?
The canonical SMILES for cyclohexanol;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.OC1CCCCC1.
What is the InChIKey of cyclohexanol;prop-1-en-2-ylbenzene?
The InChIKey is XPFRBKFWDQBIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C6H12O/c1-8(2)9-6-4-3-5-7-9;7-6-4-2-1-3-5-6/h3-7H,1H2,2H3;6-7H,1-5H2.
What are the key properties of cyclohexanol;prop-1-en-2-ylbenzene?
cyclohexanol;prop-1-en-2-ylbenzene has a molecular weight of 218.34 g/mol, XLogP of 4.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;prop-1-en-2-ylbenzene is sourced from PubChem (CID 69052526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).