About 4-cyclohexylcyclohexan-1-ol;toluene;hydrate
4-cyclohexylcyclohexan-1-ol;toluene;hydrate (PubChem CID 142076713) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is 4-cyclohexylcyclohexan-1-ol;toluene;hydrate.
Molecular Properties
| Compound Name | 4-cyclohexylcyclohexan-1-ol;toluene;hydrate |
| PubChem CID | 142076713 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 4-cyclohexylcyclohexan-1-ol;toluene;hydrate |
| SMILES | Cc1ccccc1.O.OC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H22O.C7H8.H2O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-7-5-3-2-4-6-7;/h10-13H,1-9H2;2-6H,1H3;1H2 |
| InChIKey | MLTOXAYFMJXYQH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexylcyclohexan-1-ol;toluene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylcyclohexan-1-ol;toluene;hydrate?
The IUPAC name of 4-cyclohexylcyclohexan-1-ol;toluene;hydrate (CID 142076713) is 4-cyclohexylcyclohexan-1-ol;toluene;hydrate.
What is the SMILES notation for 4-cyclohexylcyclohexan-1-ol;toluene;hydrate?
The canonical SMILES for 4-cyclohexylcyclohexan-1-ol;toluene;hydrate is Cc1ccccc1.O.OC1CCC(C2CCCCC2)CC1.
What is the InChIKey of 4-cyclohexylcyclohexan-1-ol;toluene;hydrate?
The InChIKey is MLTOXAYFMJXYQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C7H8.H2O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-7-5-3-2-4-6-7;/h10-13H,1-9H2;2-6H,1H3;1H2.
What are the key properties of 4-cyclohexylcyclohexan-1-ol;toluene;hydrate?
4-cyclohexylcyclohexan-1-ol;toluene;hydrate has a molecular weight of 292.46 g/mol, XLogP of 4.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylcyclohexan-1-ol;toluene;hydrate is sourced from PubChem (CID 142076713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).