About N-cyclohexylformamide;1-phenylethanone
N-cyclohexylformamide;1-phenylethanone (PubChem CID 174611681) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is N-cyclohexylformamide;1-phenylethanone.
Molecular Properties
| Compound Name | N-cyclohexylformamide;1-phenylethanone |
| PubChem CID | 174611681 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-cyclohexylformamide;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=CNC1CCCCC1 |
| InChI | InChI=1S/C8H8O.C7H13NO/c1-7(9)8-5-3-2-4-6-8;9-6-8-7-4-2-1-3-5-7/h2-6H,1H3;6-7H,1-5H2,(H,8,9) |
| InChIKey | RDGAWTHOSIFYHV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylformamide;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylformamide;1-phenylethanone?
The IUPAC name of N-cyclohexylformamide;1-phenylethanone (CID 174611681) is N-cyclohexylformamide;1-phenylethanone.
What is the SMILES notation for N-cyclohexylformamide;1-phenylethanone?
The canonical SMILES for N-cyclohexylformamide;1-phenylethanone is CC(=O)c1ccccc1.O=CNC1CCCCC1.
What is the InChIKey of N-cyclohexylformamide;1-phenylethanone?
The InChIKey is RDGAWTHOSIFYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C7H13NO/c1-7(9)8-5-3-2-4-6-8;9-6-8-7-4-2-1-3-5-7/h2-6H,1H3;6-7H,1-5H2,(H,8,9).
What are the key properties of N-cyclohexylformamide;1-phenylethanone?
N-cyclohexylformamide;1-phenylethanone has a molecular weight of 247.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylformamide;1-phenylethanone is sourced from PubChem (CID 174611681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).