About 1,1'-biphenyl;cycloheptane
1,1'-biphenyl;cycloheptane (PubChem CID 174877368) has the molecular formula C19H24
and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,1'-biphenyl;cycloheptane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;cycloheptane |
| PubChem CID | 174877368 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1,1'-biphenyl;cycloheptane |
| SMILES | C1CCCCCC1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C7H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-7-5-3-1/h1-10H;1-7H2 |
| InChIKey | NVPSDVIDSBUBDC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1'-biphenyl;cycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;cycloheptane?
The IUPAC name of 1,1'-biphenyl;cycloheptane (CID 174877368) is 1,1'-biphenyl;cycloheptane.
What is the SMILES notation for 1,1'-biphenyl;cycloheptane?
The canonical SMILES for 1,1'-biphenyl;cycloheptane is C1CCCCCC1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;cycloheptane?
The InChIKey is NVPSDVIDSBUBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C7H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-7-5-3-1/h1-10H;1-7H2.
What are the key properties of 1,1'-biphenyl;cycloheptane?
1,1'-biphenyl;cycloheptane has a molecular weight of 252.40 g/mol, XLogP of 6.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;cycloheptane is sourced from PubChem (CID 174877368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).