About 1,1'-biphenyl;sulfanylidenephosphanium
1,1'-biphenyl;sulfanylidenephosphanium (PubChem CID 161040824) has the molecular formula C12H12PS+
and a molecular weight of 219.27 g/mol. Its IUPAC name is 1,1'-biphenyl;sulfanylidenephosphanium.
Molecular Properties
| Compound Name | 1,1'-biphenyl;sulfanylidenephosphanium |
| PubChem CID | 161040824 |
| Molecular Formula | C12H12PS+ |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 1,1'-biphenyl;sulfanylidenephosphanium |
| SMILES | [PH2+]=S.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.HPS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h1-10H;1H/p+1 |
| InChIKey | GGGHVWMUHNZXAX-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;sulfanylidenephosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;sulfanylidenephosphanium?
The IUPAC name of 1,1'-biphenyl;sulfanylidenephosphanium (CID 161040824) is 1,1'-biphenyl;sulfanylidenephosphanium.
What is the SMILES notation for 1,1'-biphenyl;sulfanylidenephosphanium?
The canonical SMILES for 1,1'-biphenyl;sulfanylidenephosphanium is [PH2+]=S.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;sulfanylidenephosphanium?
The InChIKey is GGGHVWMUHNZXAX-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H10.HPS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h1-10H;1H/p+1.
What are the key properties of 1,1'-biphenyl;sulfanylidenephosphanium?
1,1'-biphenyl;sulfanylidenephosphanium has a molecular weight of 219.27 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;sulfanylidenephosphanium is sourced from PubChem (CID 161040824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).