C14H22INO2 — CID 21392898
6-(diethylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol;hydroiodide (PubChem CID 21392898) has the molecular formula C14H22INO2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 6-(diethylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol;hydroiodide.
| Compound Name | 6-(diethylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol;hydroiodide |
|---|---|
| PubChem CID | 21392898 |
| Molecular Formula | C14H22INO2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 6-(diethylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol;hydroiodide |
| SMILES | CCN(CC)C1CCc2c(ccc(O)c2O)C1.I |
| InChI | InChI=1S/C14H21NO2.HI/c1-3-15(4-2)11-6-7-12-10(9-11)5-8-13(16)14(12)17;/h5,8,11,16-17H,3-4,6-7,9H2,1-2H3;1H |
| InChIKey | IGLPAANIUQAFDQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|